1,3-di-tert-Butyl-1H-imidazol-3-ium chloride, 97%
cas: 157197-54-1 — see every product listed under this CAS number, including other names
1,3-di-tert-Butyl-1H-imidazol-3-ium chloride, 97% (CAS 157197-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A679473-250mg |
| cas | 157197-54-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 876.56 Pln | |
| Ambeed | 5g | 2884.62 Pln | |
| Fluorochem | 10g | 5568.89 Pln | |
| Fluorochem | 25g | 13545.25 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 872.63 Pln | |
| Fluorochem | 5g | 2950.02 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 936.36 Pln | |
| BLDpharm | 5g | 3107.82 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,3-ditert-butylimidazol-1-ium chloride (CAS 157197-54-1) is a chemical compound with the molecular formula C11H21ClN2 and a molecular weight of 216.75 g/mol. IUPAC name: 1,3-ditert-butylimidazol-1-ium chloride. InChIKey: GJECSWIRMFBYOI-UHFFFAOYSA-M.
| Molecular formula | C11H21ClN2 |
|---|---|
| Molecular weight | 216.75 g/mol |
| IUPAC name | 1,3-ditert-butylimidazol-1-ium chloride |
| InChIKey | GJECSWIRMFBYOI-UHFFFAOYSA-M |
| SMILES | CC(C)(C)N1C=C[N+](=C1)C(C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
1,3-di-tert-Butyl-1H-imidazol-3-ium chloride, 1,3-di-t-butylimidazolium chloride, 1,3-ditert-butylimidazol-1-ium;chloride, 1,3-di-tert-butylimidazolium chloride, 1,3-di-tert-Butyl-1H-imidazol-3-iumchloride, 1,3-di-tert-Butyl-1H-imidazol-3-iumc, 1(3)-di-tert-Butyl-1H-imidazol-3-ium chloride