CAS 157197-54-1 is the registry number for 1,3-DI-TERT-BUTYL-1H-IMIDAZOL-3-IUM CHLORIDE, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1,3-ditert-butylimidazol-1-ium chloride (CAS 157197-54-1) is a chemical compound with the molecular formula C11H21ClN2 and a molecular weight of 216.75 g/mol. IUPAC name: 1,3-ditert-butylimidazol-1-ium chloride. InChIKey: GJECSWIRMFBYOI-UHFFFAOYSA-M.
| Molecular formula | C11H21ClN2 |
|---|---|
| Molecular weight | 216.75 g/mol |
| IUPAC name | 1,3-ditert-butylimidazol-1-ium chloride |
| InChIKey | GJECSWIRMFBYOI-UHFFFAOYSA-M |
| SMILES | CC(C)(C)N1C=C[N+](=C1)C(C)(C)C.[Cl-] |
Computed by PubChem (NCBI)