cas: 136861-46-6 — see every product listed under this CAS number, including other names
1,4-Bis(((4-methylbenzyl)oxy)methyl)benzene, 98% (CAS 136861-46-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722468-250MG |
| cas | 136861-46-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 966.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,4-bis[(4-methylphenyl)methoxymethyl]benzene (CAS 136861-46-6) is a chemical compound with the molecular formula C24H26O2 and a molecular weight of 346.5 g/mol. IUPAC name: 1,4-bis[(4-methylphenyl)methoxymethyl]benzene. InChIKey: IJMQICMKIDWWAK-UHFFFAOYSA-N.
| Molecular formula | C24H26O2 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 1,4-bis[(4-methylphenyl)methoxymethyl]benzene |
| InChIKey | IJMQICMKIDWWAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COCC2=CC=C(C=C2)COCC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)