cas: 136861-46-6 — see every product listed under this CAS number, including other names
alpha,alpha'-Bis(4-methylbenzyloxy)-p-xylene, >98.0%(GC) (CAS 136861-46-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1482-1G |
| cas | 136861-46-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 733.00 Pln | |
| TCI | 5g | 2404.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,4-bis[(4-methylphenyl)methoxymethyl]benzene (CAS 136861-46-6) is a chemical compound with the molecular formula C24H26O2 and a molecular weight of 346.5 g/mol. IUPAC name: 1,4-bis[(4-methylphenyl)methoxymethyl]benzene. InChIKey: IJMQICMKIDWWAK-UHFFFAOYSA-N.
| Molecular formula | C24H26O2 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 1,4-bis[(4-methylphenyl)methoxymethyl]benzene |
| InChIKey | IJMQICMKIDWWAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COCC2=CC=C(C=C2)COCC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)