cas: 66300-61-6 — see every product listed under this CAS number, including other names
1,4-Bis(2,2,2-trifluoroethoxy)benzene 99% (CAS 66300-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A960779-1g |
| cas | 66300-61-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 2167.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A960779 |
1,4-bis(2,2,2-trifluoroethoxy)benzene (CAS 66300-61-6) is a chemical compound with the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. IUPAC name: 1,4-bis(2,2,2-trifluoroethoxy)benzene. InChIKey: ZHUBFESHPMGIDZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O2 |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 1,4-bis(2,2,2-trifluoroethoxy)benzene |
| InChIKey | ZHUBFESHPMGIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(F)(F)F)OCC(F)(F)F |
Computed by PubChem (NCBI)