cas: 66300-61-6 — see every product listed under this CAS number, including other names
1,4-Bis(2,2,2-trifluoroethoxy)benzene, 96%, 96% (CAS 66300-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DNH-100mg |
| cas | 66300-61-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 371.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1,4-bis(2,2,2-trifluoroethoxy)benzene (CAS 66300-61-6) is a chemical compound with the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. IUPAC name: 1,4-bis(2,2,2-trifluoroethoxy)benzene. InChIKey: ZHUBFESHPMGIDZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O2 |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 1,4-bis(2,2,2-trifluoroethoxy)benzene |
| InChIKey | ZHUBFESHPMGIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(F)(F)F)OCC(F)(F)F |
Computed by PubChem (NCBI)