Products 131803-37-7
CAS 131803-37-7 appears in our catalog under these names: 1,4-Bis(chloromethyl)-2,3,5,6-tetrafluorobenzene, 98%, 1,4-Bis(chloromethyl)tetrafluorobenzene, 96%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene (CAS 131803-37-7) is a chemical compound with the molecular formula C8H4Cl2F4 and a molecular weight of 247.01 g/mol. IUPAC name: 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene. InChIKey: WEUAASLFNKTIIM-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F4 |
|---|---|
| Molecular weight | 247.01 g/mol |
| IUPAC name | 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene |
| InChIKey | WEUAASLFNKTIIM-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)CCl)F)F)Cl |
Computed by PubChem (NCBI)