Products 2088945-25-7
CAS 2088945-25-7 is the registry number for 1-(Dichloromethyl)-2-fluoro-3-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dichloromethyl)-2-fluoro-3-(trifluoromethyl)benzene (CAS 2088945-25-7) is a chemical compound with the molecular formula C8H4Cl2F4 and a molecular weight of 247.01 g/mol. IUPAC name: 1-(dichloromethyl)-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: SZISCPFOEMSPLN-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F4 |
|---|---|
| Molecular weight | 247.01 g/mol |
| IUPAC name | 1-(dichloromethyl)-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | SZISCPFOEMSPLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(Cl)Cl |
Computed by PubChem (NCBI)