1,4-Di(pyren-1-yl)benzene, 98%
cas: 475460-77-6 — see every product listed under this CAS number, including other names
1,4-Di(pyren-1-yl)benzene, 98% (CAS 475460-77-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Fluorochem, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F869403-1G |
| cas | 475460-77-6 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 305.12 Pln | |
| Fluorochem | 5g | 810.15 Pln | |
| Fluorochem | 10g | 1554.68 Pln | |
| Fluorochem | 25g | 3731.00 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Chemat | 10g | 1173.20 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 853.06 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1-(4-pyren-1-ylphenyl)pyrene (CAS 475460-77-6) is a chemical compound with the molecular formula C38H22 and a molecular weight of 478.6 g/mol. IUPAC name: 1-(4-pyren-1-ylphenyl)pyrene. InChIKey: IJJYNFWMKNYNEW-UHFFFAOYSA-N.
| Molecular formula | C38H22 |
|---|---|
| Molecular weight | 478.6 g/mol |
| IUPAC name | 1-(4-pyren-1-ylphenyl)pyrene |
| InChIKey | IJJYNFWMKNYNEW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C5=CC=C(C=C5)C6=C7C=CC8=CC=CC9=C8C7=C(C=C9)C=C6 |
Computed by PubChem (NCBI)