CAS 1616657-81-8 appears in our catalog under these names: 1,3-Di(pyren-2-yl)benzene, 99%, Poly((9,9-dioctyl-2,7-divinylenefluorenylene)-alt-(4,4'-biphenylene)). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
2-(3-pyren-2-ylphenyl)pyrene (CAS 1616657-81-8) is a chemical compound with the molecular formula C38H22 and a molecular weight of 478.6 g/mol. IUPAC name: 2-(3-pyren-2-ylphenyl)pyrene. InChIKey: YDJCWUAHCTZCGQ-UHFFFAOYSA-N.
| Molecular formula | C38H22 |
|---|---|
| Molecular weight | 478.6 g/mol |
| IUPAC name | 2-(3-pyren-2-ylphenyl)pyrene |
| InChIKey | YDJCWUAHCTZCGQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC(=C4)C5=CC(=CC=C5)C6=CC7=C8C(=C6)C=CC9=C8C(=CC=C9)C=C7)C=C2 |
Computed by PubChem (NCBI)