cas: 170011-47-9 — see every product listed under this CAS number, including other names
1,4-Dioxaspiro(4.5)dec-7-en-8-yl trifluoromethanesulfonate, 95-<97% (CAS 170011-47-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC4457-95-97-5g |
| cas | 170011-47-9 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 6656.10 Pln | |
| Hoffman Fine Chemicals | 10g | 10094.92 Pln | |
| Hoffman Fine Chemicals | 25g | 19875.46 Pln | |
| Hoffman Fine Chemicals | 50g | 31621.04 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate (CAS 170011-47-9) is a chemical compound with the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate. InChIKey: NOLMGELTBIIGOL-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O5S |
|---|---|
| Molecular weight | 288.24 g/mol |
| IUPAC name | 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate |
| InChIKey | NOLMGELTBIIGOL-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1OS(=O)(=O)C(F)(F)F)OCCO2 |
Computed by PubChem (NCBI)