CAS 122539-74-6 appears in our catalog under these names: Ethyl 2-(trifluoromethylsulfonyloxy)cyclopent-1-enecarboxylate, 95%, Ethyl 2-(((trifluoromethyl)sulfonyl)oxy)cyclopent-1-enecarboxylate 95%, Ethyl 2-(((trifluoromethyl)sulfonyl)oxy)cyclopent-1-enecarboxylate. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate (CAS 122539-74-6) is a chemical compound with the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. IUPAC name: ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate. InChIKey: ZFLPJHGXVFJDCI-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O5S |
|---|---|
| Molecular weight | 288.24 g/mol |
| IUPAC name | ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate |
| InChIKey | ZFLPJHGXVFJDCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CCC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)