1,4-Phenylenediboronic acid, 97%
cas: 4612-26-4 — see every product listed under this CAS number, including other names
1,4-Phenylenediboronic acid, 97% (CAS 4612-26-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F045301-1G |
| cas | 4612-26-4 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 148.92 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Fluorochem | 250g | 1309.97 Pln | |
| Fluorochem | 500g | 2543.91 Pln | |
| Fluorochem | 1kg | 4491.14 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 570.62 Pln | |
| Ambeed | 500g | 2578.69 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(4-boronophenyl)boronic acid (CAS 4612-26-4) is a chemical compound with the molecular formula C6H8B2O4 and a molecular weight of 165.75 g/mol. IUPAC name: (4-boronophenyl)boronic acid. InChIKey: BODYVHJTUHHINQ-UHFFFAOYSA-N.
| Molecular formula | C6H8B2O4 |
|---|---|
| Molecular weight | 165.75 g/mol |
| IUPAC name | (4-boronophenyl)boronic acid |
| InChIKey | BODYVHJTUHHINQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)B(O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1,4-Benzenediboronic acid, 1,4-Phenylenediboronic Acid, 1,4-Phenylenebisboronic acid, Benzene-1,4-diboronic acid, (4-boronophenyl)boronic acid, p-Benzenediboronic acid, 1,4-phenylenebis(boronic acid), Boronic acid, 1,4-phenylenebis-, [4-(dihydroxyboranyl)phenyl]boronic acid, p-Phenylenediboronic acid