(4-Bromo-2-methylphenyl)boronic acid, 95%
cas: 221006-71-9 — see every product listed under this CAS number, including other names
(4-Bromo-2-methylphenyl)boronic acid, 95% (CAS 221006-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11BECZ-100mg |
| cas | 221006-71-9 |
| size | 100mg |
| availability | 400g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 424.40 Pln | |
| Chemat | 10g | 784.40 Pln | |
| Chemat | 25g | 1859.60 Pln | |
| Chemat | 100g | 5819.60 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 523.79 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Fluorochem | 25g | 1664.02 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-bromo-2-methylphenyl)boronic acid (CAS 221006-71-9) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (4-bromo-2-methylphenyl)boronic acid. InChIKey: BEQUDVVISBTSHZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (4-bromo-2-methylphenyl)boronic acid |
| InChIKey | BEQUDVVISBTSHZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)C)(O)O |
Computed by PubChem (NCBI)