cas: 5625-56-9 — see every product listed under this CAS number, including other names
1,4-Piperazinedipropanesulfonic acid (CAS 5625-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494200-1G |
| cas | 5625-56-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 1127.75 Pln | |
| Fluorochem | 100g | 3829.92 Pln |
| delivery time | 2-3 weeks |
|---|
3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid (CAS 5625-56-9) is a chemical compound with the molecular formula C10H22N2O6S2 and a molecular weight of 330.4 g/mol. IUPAC name: 3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid. InChIKey: PDLPTSJWDUCMKS-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O6S2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid |
| InChIKey | PDLPTSJWDUCMKS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCS(=O)(=O)O)CCCS(=O)(=O)O |
Computed by PubChem (NCBI)