cas: 5625-56-9 — see every product listed under this CAS number, including other names
1,4-Piperazinedipropanesulfonicacid, ≥97%, ≥97% (CAS 5625-56-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IA2M-5g |
| cas | 5625-56-9 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 602.00 Pln | |
| Chemat | 100g | 1989.20 Pln | |
| Chemat | 500g | 5918.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid (CAS 5625-56-9) is a chemical compound with the molecular formula C10H22N2O6S2 and a molecular weight of 330.4 g/mol. IUPAC name: 3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid. InChIKey: PDLPTSJWDUCMKS-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O6S2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 3-[4-(3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid |
| InChIKey | PDLPTSJWDUCMKS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCS(=O)(=O)O)CCCS(=O)(=O)O |
Computed by PubChem (NCBI)