Products 174913-38-3

CAS 174913-38-3 is the registry number for 1,5-Dibromo-2-chloro-4-methoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,5-dibromo-2-chloro-4-methoxybenzene (CAS 174913-38-3) is a chemical compound with the molecular formula C7H5Br2ClO and a molecular weight of 300.37 g/mol. IUPAC name: 1,5-dibromo-2-chloro-4-methoxybenzene. InChIKey: OTZRCEAVEJYZQS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2ClO
Molecular weight300.37 g/mol
IUPAC name1,5-dibromo-2-chloro-4-methoxybenzene
InChIKeyOTZRCEAVEJYZQS-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1Br)Br)Cl

Computed by PubChem (NCBI)