CAS 174913-35-0 appears in our catalog under these names: 5-Chloro-2,3-dibromoanisole, 97%, 1,2-Dibromo-5-chloro-3-methoxybenzene, 98%, 5-Chloro-2,3-dibromoanisole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
1,2-dibromo-5-chloro-3-methoxybenzene (CAS 174913-35-0) is a chemical compound with the molecular formula C7H5Br2ClO and a molecular weight of 300.37 g/mol. IUPAC name: 1,2-dibromo-5-chloro-3-methoxybenzene. InChIKey: JDEXVOQSUCJVJE-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2ClO |
|---|---|
| Molecular weight | 300.37 g/mol |
| IUPAC name | 1,2-dibromo-5-chloro-3-methoxybenzene |
| InChIKey | JDEXVOQSUCJVJE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Cl)Br)Br |
Computed by PubChem (NCBI)