cas: 3868-03-9 — see every product listed under this CAS number, including other names
1,6:2,3-Dianhydro-β-D-mannopyranose, 97%, 97% (CAS 3868-03-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 100mg, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C0OQ-50mg |
| cas | 3868-03-9 |
| size | 50mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 25g | 4542.80 Pln | |
| Chemat | 100g | 13499.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol (CAS 3868-03-9) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol. InChIKey: RXDFVNWKKAAOSK-RWOPYEJCSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol |
| InChIKey | RXDFVNWKKAAOSK-RWOPYEJCSA-N |
| SMILES | C1[C@@H]2[C@H]([C@H]3[C@H](O3)[C@H](O1)O2)O |
Computed by PubChem (NCBI)