cas: 3868-03-9 — see every product listed under this CAS number, including other names
1,6:2,3-Dianhydro-b-D-mannopyranose (CAS 3868-03-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM23910C-10g |
| cas | 3868-03-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 8554.68 Pln | |
| Chemat | 1g | 1929.08 Pln | |
| Chemat | 2g | 2967.60 Pln | |
| Chemat | 5g | 5390.09 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol (CAS 3868-03-9) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol. InChIKey: RXDFVNWKKAAOSK-RWOPYEJCSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol |
| InChIKey | RXDFVNWKKAAOSK-RWOPYEJCSA-N |
| SMILES | C1[C@@H]2[C@H]([C@H]3[C@H](O3)[C@H](O1)O2)O |
Computed by PubChem (NCBI)