Products 6893-59-0
CAS 6893-59-0 appears in our catalog under these names: 1,6:2,3-Dianhydro-β-D-talopyranose, 1,6, 2,3-Dianhydro-beta-D-talopyranose. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 1000mg.
(1R,2S,4S,5S,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol (CAS 6893-59-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (1R,2S,4S,5S,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol. InChIKey: RXDFVNWKKAAOSK-QBFJYBIGSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (1R,2S,4S,5S,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-ol |
| InChIKey | RXDFVNWKKAAOSK-QBFJYBIGSA-N |
| SMILES | C1[C@@H]2[C@@H]([C@H]3[C@H](O3)[C@H](O1)O2)O |
Computed by PubChem (NCBI)