Products 81353-56-2
CAS 81353-56-2 is the registry number for 1,6-Dibromophenazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,6-dibromophenazine (CAS 81353-56-2) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 1,6-dibromophenazine. InChIKey: NVTPLEYFJCLPHO-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 1,6-dibromophenazine |
| InChIKey | NVTPLEYFJCLPHO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C3C=CC=C(C3=N2)Br |
Computed by PubChem (NCBI)