1,6-Dibromophenazine, 95%
cas: 81353-56-2 — see every product listed under this CAS number, including other names
1,6-Dibromophenazine, 95% (CAS 81353-56-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2836270-100mg |
| cas | 81353-56-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 809.81 Pln | |
| Ambeed | 5g | 2645.44 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 369.89 Pln | |
| BLDpharm | 1g | 869.72 Pln | |
| BLDpharm | 5g | 2846.80 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 2080.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,6-dibromophenazine (CAS 81353-56-2) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 1,6-dibromophenazine. InChIKey: NVTPLEYFJCLPHO-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 1,6-dibromophenazine |
| InChIKey | NVTPLEYFJCLPHO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C3C=CC=C(C3=N2)Br |
Computed by PubChem (NCBI)