CAS 39069-02-8 appears in our catalog under these names: 2,9–Dibromo–1,10–phenanthroline, 2,9-dibromo-1,10-phenanthroline, 95%, 95%, 2,9-Dibromo-1,10-phenanthroline, 95%, 2,9-Dibromo-1,10-phenanthroline, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250g, 500g, 1kg, 100mg, 250mg, 10g.
2,9-dibromo-1,10-phenanthroline (CAS 39069-02-8) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 2,9-dibromo-1,10-phenanthroline. InChIKey: QNLGXYVSHITTGT-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 2,9-dibromo-1,10-phenanthroline |
| InChIKey | QNLGXYVSHITTGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br |
Computed by PubChem (NCBI)