cas: 202584-14-3 — see every product listed under this CAS number, including other names
1,6-Dimethyl-1H-indole-3-carbaldehyde 98% (CAS 202584-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A606152-100mg |
| cas | 202584-14-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A606152 |
1,6-dimethylindole-3-carbaldehyde (CAS 202584-14-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 1,6-dimethylindole-3-carbaldehyde. InChIKey: VFOVAOMIZCNUDY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1,6-dimethylindole-3-carbaldehyde |
| InChIKey | VFOVAOMIZCNUDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2C)C=O |
Computed by PubChem (NCBI)