cas: 1800-91-5 — see every product listed under this CAS number, including other names
1,6-Divinylperfluorohexane, 98%, 98% (CAS 1800-91-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132LC-250mg |
| cas | 1800-91-5 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1605.20 Pln | |
| Chemat | 100g | 5858.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene (CAS 1800-91-5) is a chemical compound with the molecular formula C10H6F12 and a molecular weight of 354.13 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene. InChIKey: PDFSXHZXNZCKNF-UHFFFAOYSA-N.
| Molecular formula | C10H6F12 |
|---|---|
| Molecular weight | 354.13 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene |
| InChIKey | PDFSXHZXNZCKNF-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(C(C(C=C)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)