CAS 1800-91-5 appears in our catalog under these names: 1,6-Divinylperfluorohexane, 95%, 3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluorodeca-1,9-diene, >98.0%(GC), 1,6-Divinylperfluorohexane, 98%, 98%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene (CAS 1800-91-5) is a chemical compound with the molecular formula C10H6F12 and a molecular weight of 354.13 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene. InChIKey: PDFSXHZXNZCKNF-UHFFFAOYSA-N.
| Molecular formula | C10H6F12 |
|---|---|
| Molecular weight | 354.13 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene |
| InChIKey | PDFSXHZXNZCKNF-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(C(C(C=C)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)