CAS 1159827-18-5 is the registry number for 1,7-Naphthyridine-8-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1,7-naphthyridine-8-carbonitrile (CAS 1159827-18-5) is a chemical compound with the molecular formula C9H5N3 and a molecular weight of 155.16 g/mol. IUPAC name: 1,7-naphthyridine-8-carbonitrile. InChIKey: OAMDZBWHIUFVKO-UHFFFAOYSA-N.
| Molecular formula | C9H5N3 |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | 1,7-naphthyridine-8-carbonitrile |
| InChIKey | OAMDZBWHIUFVKO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)C#N)N=C1 |
Computed by PubChem (NCBI)