CAS 1142927-37-4 appears in our catalog under these names: 1,5-Naphthyridine-3-carbonitrile, 95%, 1,5-Naphthyridine-3-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1,5-naphthyridine-3-carbonitrile (CAS 1142927-37-4) is a chemical compound with the molecular formula C9H5N3 and a molecular weight of 155.16 g/mol. IUPAC name: 1,5-naphthyridine-3-carbonitrile. InChIKey: HVWXIFKFFMJTJB-UHFFFAOYSA-N.
| Molecular formula | C9H5N3 |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | 1,5-naphthyridine-3-carbonitrile |
| InChIKey | HVWXIFKFFMJTJB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C#N)N=C1 |
Computed by PubChem (NCBI)