cas: 401788-98-5 — see every product listed under this CAS number, including other names
1–Butyl–3–methylimidazolium methyl sulfate (CAS 401788-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 500g, 50g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD03303-100g |
| cas | 401788-98-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1271.03 Pln | |
| GLPBio | 25g | 709.37 Pln | |
| GLPBio | 500g | 3929.56 Pln | |
| GLPBio | 50g | 901.27 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-butyl-3-methylimidazol-3-ium;methyl sulfate (CAS 401788-98-5) is a chemical compound with the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;methyl sulfate. InChIKey: MEMNKNZDROKJHP-UHFFFAOYSA-M.
| Molecular formula | C9H18N2O4S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;methyl sulfate |
| InChIKey | MEMNKNZDROKJHP-UHFFFAOYSA-M |
| SMILES | CCCCN1C=C[N+](=C1)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)