CAS 401788-98-5 appears in our catalog under these names: 1-Butyl-3-methylimidazolium methyl sulfate, 98%, 3-Butyl-1-methyl-1H-imidazol-3-ium methyl sulfate, 98%, 1–Butyl–3–methylimidazolium methyl sulfate, 1-n-Butyl-3-methylimidazolium methyl sulfate, 99% , 1-Butyl-3-methylimidazolium Methyl Sulfate, >98.0%(HPLC). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 100g, 500g, 50g.
1-butyl-3-methylimidazol-3-ium;methyl sulfate (CAS 401788-98-5) is a chemical compound with the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;methyl sulfate. InChIKey: MEMNKNZDROKJHP-UHFFFAOYSA-M.
| Molecular formula | C9H18N2O4S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;methyl sulfate |
| InChIKey | MEMNKNZDROKJHP-UHFFFAOYSA-M |
| SMILES | CCCCN1C=C[N+](=C1)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)