cas: 4200-06-0 — see every product listed under this CAS number, including other names
1–Ethynyl–4–phenoxybenzene (CAS 4200-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD12272-100mg |
| cas | 4200-06-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 550.23 Pln | |
| GLPBio | 1g | 929.36 Pln | |
| GLPBio | 250mg | 620.44 Pln | |
| GLPBio | 5g | 2258.62 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-ethynyl-4-phenoxybenzene (CAS 4200-06-0) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 1-ethynyl-4-phenoxybenzene. InChIKey: LKMNQDOAPYPSNH-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-ethynyl-4-phenoxybenzene |
| InChIKey | LKMNQDOAPYPSNH-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)