CAS 1202355-37-0 appears in our catalog under these names: 4'-Ethynyl-[1,1'-biphenyl]-4-ol, 95%, 4'–Ethynyl–(1,1'–biphenyl)–4–ol, 4'-Ethynyl-[1,1'-biphenyl]-4-ol, 95+%, 95+%, 4'-Ethynyl-[1,1'-biphenyl]-4-ol, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
4-(4-ethynylphenyl)phenol (CAS 1202355-37-0) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 4-(4-ethynylphenyl)phenol. InChIKey: DILPQBKOIIKSOX-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-(4-ethynylphenyl)phenol |
| InChIKey | DILPQBKOIIKSOX-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)