cas: 53159-92-5 — see every product listed under this CAS number, including other names
1,2,3,4-Cyclobutanetetracarboxylic Acid, 95%, 95% (CAS 53159-92-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 75g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D0P-250mg |
| cas | 53159-92-5 |
| size | 250mg |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 904.40 Pln | |
| Chemat | 25g | 1778.00 Pln | |
| Chemat | 50g | 3323.60 Pln | |
| Chemat | 75g | 4907.60 Pln | |
| Chemat | 100g | 6122.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cyclobutane-1,2,3,4-tetracarboxylic acid (CAS 53159-92-5) is a chemical compound with the molecular formula C8H8O8 and a molecular weight of 232.14 g/mol. IUPAC name: cyclobutane-1,2,3,4-tetracarboxylic acid. InChIKey: CURBACXRQKTCKZ-UHFFFAOYSA-N.
| Molecular formula | C8H8O8 |
|---|---|
| Molecular weight | 232.14 g/mol |
| IUPAC name | cyclobutane-1,2,3,4-tetracarboxylic acid |
| InChIKey | CURBACXRQKTCKZ-UHFFFAOYSA-N |
| SMILES | C1(C(C(C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)