Products 3892-04-4

CAS 3892-04-4 is the registry number for Malic Acid Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid (CAS 3892-04-4) is a chemical compound with the molecular formula C8H8O8 and a molecular weight of 232.14 g/mol. IUPAC name: 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid. InChIKey: LWXITGFSKAEHEM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O8
Molecular weight232.14 g/mol
IUPAC name2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid
InChIKeyLWXITGFSKAEHEM-UHFFFAOYSA-N
SMILESC(C1C(=O)OC(C(=O)O1)CC(=O)O)C(=O)O

Computed by PubChem (NCBI)