CAS 3892-04-4 is the registry number for Malic Acid Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid (CAS 3892-04-4) is a chemical compound with the molecular formula C8H8O8 and a molecular weight of 232.14 g/mol. IUPAC name: 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid. InChIKey: LWXITGFSKAEHEM-UHFFFAOYSA-N.
| Molecular formula | C8H8O8 |
|---|---|
| Molecular weight | 232.14 g/mol |
| IUPAC name | 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dioxan-2-yl]acetic acid |
| InChIKey | LWXITGFSKAEHEM-UHFFFAOYSA-N |
| SMILES | C(C1C(=O)OC(C(=O)O1)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)