1-((3,5-Difluorophenyl)sulfonyl)bicyclo[2.1.0]pentane, 98%
cas: 1862202-00-3 — see every product listed under this CAS number, including other names
1-((3,5-Difluorophenyl)sulfonyl)bicyclo[2.1.0]pentane, 98% (CAS 1862202-00-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1521841-100mg |
| cas | 1862202-00-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 1210.31 Pln | |
| Ambeed | 1g | 3134.94 Pln | |
| Ambeed | 5g | 12318.62 Pln | |
| BLDpharm | 100mg | 703.11 Pln | |
| BLDpharm | 250mg | 1180.72 Pln | |
| BLDpharm | 1g | 3068.94 Pln | |
| BLDpharm | 5g | 12087.99 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 885.20 Pln | |
| Chemat | 1g | 2282.00 Pln | |
| Fluorochem | 100mg | 992.38 Pln | |
| Fluorochem | 250mg | 1643.19 Pln | |
| Fluorochem | 1g | 4225.61 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane (CAS 1862202-00-3) is a chemical compound with the molecular formula C11H10F2O2S and a molecular weight of 244.26 g/mol. IUPAC name: 1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane. InChIKey: IZBMPDKWKGIJQD-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2S |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane |
| InChIKey | IZBMPDKWKGIJQD-UHFFFAOYSA-N |
| SMILES | C1CC2(C1C2)S(=O)(=O)C3=CC(=CC(=C3)F)F |
Computed by PubChem (NCBI)