Products 1862202-00-3
CAS 1862202-00-3 is the registry number for 1-((3,5-Difluorophenyl)sulfonyl)bicyclo[2.1.0]pentane, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane (CAS 1862202-00-3) is a chemical compound with the molecular formula C11H10F2O2S and a molecular weight of 244.26 g/mol. IUPAC name: 1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane. InChIKey: IZBMPDKWKGIJQD-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2S |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane |
| InChIKey | IZBMPDKWKGIJQD-UHFFFAOYSA-N |
| SMILES | C1CC2(C1C2)S(=O)(=O)C3=CC(=CC(=C3)F)F |
Computed by PubChem (NCBI)