1-((6-Bromopyridin-2-yl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 95%
cas: 2172959-09-8 — see every product listed under this CAS number, including other names
1-((6-Bromopyridin-2-yl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 95% (CAS 2172959-09-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2760855-250mg |
| cas | 2172959-09-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1204.75 Pln | |
| Ambeed | 1g | 3262.88 Pln | |
| BLDpharm | 50mg | 508.73 Pln | |
| BLDpharm | 100mg | 814.18 Pln | |
| BLDpharm | 250mg | 1291.79 Pln | |
| BLDpharm | 1g | 3468.80 Pln | |
| Chemat | 100mg | 770.00 Pln | |
| Chemat | 250mg | 1264.40 Pln | |
| Chemat | 1g | 3314.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide (CAS 2172959-09-8) is a chemical compound with the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. IUPAC name: 1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide. InChIKey: LRIALEDQSSLFGZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2OS |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide |
| InChIKey | LRIALEDQSSLFGZ-UHFFFAOYSA-N |
| SMILES | C1CCS(=NC2=NC(=CC=C2)Br)(=O)C1 |
Computed by PubChem (NCBI)