Products 2172959-09-8
CAS 2172959-09-8 appears in our catalog under these names: 1-((6-Bromopyridin-2-yl)imino)tetrahydro-1H-1l6-thiophene 1-oxide 95%, 1-((6-Bromopyridin-2-yl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide (CAS 2172959-09-8) is a chemical compound with the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. IUPAC name: 1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide. InChIKey: LRIALEDQSSLFGZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2OS |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 1-[(6-bromo-2-pyridinyl)imino]thiolane 1-oxide |
| InChIKey | LRIALEDQSSLFGZ-UHFFFAOYSA-N |
| SMILES | C1CCS(=NC2=NC(=CC=C2)Br)(=O)C1 |
Computed by PubChem (NCBI)