1-((Phenylthio)methyl)pyridin-1-ium chloride, 95%
cas: 108921-80-8 — see every product listed under this CAS number, including other names
1-((Phenylthio)methyl)pyridin-1-ium chloride, 95% (CAS 108921-80-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2315407-250mg |
| cas | 108921-80-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 237.20 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 864.16 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(phenylsulfanylmethyl)pyridin-1-ium chloride (CAS 108921-80-8) is a chemical compound with the molecular formula C12H12ClNS and a molecular weight of 237.75 g/mol. IUPAC name: 1-(phenylsulfanylmethyl)pyridin-1-ium chloride. InChIKey: AYOAABZGKLPFCA-UHFFFAOYSA-M.
| Molecular formula | C12H12ClNS |
|---|---|
| Molecular weight | 237.75 g/mol |
| IUPAC name | 1-(phenylsulfanylmethyl)pyridin-1-ium chloride |
| InChIKey | AYOAABZGKLPFCA-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)SC[N+]2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)