CAS 92902-55-1 is the registry number for 3-(Phenylsulfanyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-phenylsulfanylaniline;hydrochloride (CAS 92902-55-1) is a chemical compound with the molecular formula C12H12ClNS and a molecular weight of 237.75 g/mol. IUPAC name: 3-phenylsulfanylaniline;hydrochloride. InChIKey: JBNPXZDDLIRRTF-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNS |
|---|---|
| Molecular weight | 237.75 g/mol |
| IUPAC name | 3-phenylsulfanylaniline;hydrochloride |
| InChIKey | JBNPXZDDLIRRTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)