cas: 1268810-07-6 — see every product listed under this CAS number, including other names
1-((Trimethylsilyl)ethynyl)cyclopropane-1-carboxylic acid, 98% (CAS 1268810-07-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F790124-100MG |
| cas | 1268810-07-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2434.58 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 2367.31 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 2186.00 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-(2-trimethylsilylethynyl)cyclopropane-1-carboxylic acid (CAS 1268810-07-6) is a chemical compound with the molecular formula C9H14O2Si and a molecular weight of 182.29 g/mol. IUPAC name: 1-(2-trimethylsilylethynyl)cyclopropane-1-carboxylic acid. InChIKey: HZGALDCSOVHAQW-UHFFFAOYSA-N.
| Molecular formula | C9H14O2Si |
|---|---|
| Molecular weight | 182.29 g/mol |
| IUPAC name | 1-(2-trimethylsilylethynyl)cyclopropane-1-carboxylic acid |
| InChIKey | HZGALDCSOVHAQW-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1(CC1)C(=O)O |
Computed by PubChem (NCBI)