CAS 22868-26-4 is the registry number for (4-Methoxyphenyl)dimethylsilanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Hydroxy-(4-methoxyphenyl)-dimethylsilane (CAS 22868-26-4) is a chemical compound with the molecular formula C9H14O2Si and a molecular weight of 182.29 g/mol. IUPAC name: hydroxy-(4-methoxyphenyl)-dimethylsilane. InChIKey: DDLYKNBMTGBOQY-UHFFFAOYSA-N.
| Molecular formula | C9H14O2Si |
|---|---|
| Molecular weight | 182.29 g/mol |
| IUPAC name | hydroxy-(4-methoxyphenyl)-dimethylsilane |
| InChIKey | DDLYKNBMTGBOQY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)[Si](C)(C)O |
Computed by PubChem (NCBI)