cas: 120728-10-1 — see every product listed under this CAS number, including other names
1-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 97%, 97% (CAS 120728-10-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146CF-1g |
| cas | 120728-10-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 120728-10-1) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: ROVVUKFHORPDSM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | ROVVUKFHORPDSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)C(=O)O |
Computed by PubChem (NCBI)