Products 1393442-42-6

CAS 1393442-42-6 is the registry number for tert-Butyl 2-(2-oxo-1,3-oxazinan-3-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(2-oxo-1,3-oxazinan-3-yl)acetate (CAS 1393442-42-6) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl 2-(2-oxo-1,3-oxazinan-3-yl)acetate. InChIKey: XGIVXHYQXDPQSF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO4
Molecular weight215.25 g/mol
IUPAC nametert-butyl 2-(2-oxo-1,3-oxazinan-3-yl)acetate
InChIKeyXGIVXHYQXDPQSF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CN1CCCOC1=O

Computed by PubChem (NCBI)