cas: 1119452-31-1 — see every product listed under this CAS number, including other names
1-(1-(tert-Butoxycarbonyl)piperidin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid 95+% (CAS 1119452-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333270-100mg |
| cas | 1119452-31-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 1927.88 Pln | |
| Ambeed | 10g | 3324.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A333270 |
1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid (CAS 1119452-31-1) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid. InChIKey: SFMQXOOIHUKDLZ-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid |
| InChIKey | SFMQXOOIHUKDLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)