cas: 1119452-31-1 — see every product listed under this CAS number, including other names
4-(4-Carboxy-[1,2,3]triazol-1-yl)-piperidine-1-carboxylic acid tert-butyl ester, 95% (CAS 1119452-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044132-250MG |
| cas | 1119452-31-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 2450.20 Pln | |
| Fluorochem | 10g | 4829.57 Pln | |
| Fluorochem | 25g | 10525.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid (CAS 1119452-31-1) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid. InChIKey: SFMQXOOIHUKDLZ-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]triazole-4-carboxylic acid |
| InChIKey | SFMQXOOIHUKDLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)