cas: 1188263-60-6 — see every product listed under this CAS number, including other names
1-(1-Benzyl-1H-pyrazol-4-yl)-ethanone 95% (CAS 1188263-60-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A998256-1g |
| cas | 1188263-60-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 1399.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A998256 |
1-(1-benzylpyrazol-4-yl)ethanone (CAS 1188263-60-6) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-(1-benzylpyrazol-4-yl)ethanone. InChIKey: NOKBKNYKUSDAPF-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-(1-benzylpyrazol-4-yl)ethanone |
| InChIKey | NOKBKNYKUSDAPF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(N=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)