CAS 119924-92-4 appears in our catalog under these names: 1-(4-(2-Methylimidazol-1-yl)phenyl)ethanone, 1-[4-(2-Methylimidazol-1-yl)phenyl]ethanone, 96%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
1-[4-(2-methylimidazol-1-yl)phenyl]ethanone (CAS 119924-92-4) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-[4-(2-methylimidazol-1-yl)phenyl]ethanone. InChIKey: LIIAUYRAXKEBGA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-[4-(2-methylimidazol-1-yl)phenyl]ethanone |
| InChIKey | LIIAUYRAXKEBGA-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1C2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)