cas: 2304635-54-7 — see every product listed under this CAS number, including other names
1-(1-Methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 2304635-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JP9A-100mg |
| cas | 2304635-54-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 1941.20 Pln | |
| Chemat | 500mg | 3194.00 Pln | |
| Chemat | 1g | 4754.00 Pln | |
| Chemat | 5g | 14142.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2304635-54-7) is a chemical compound with the molecular formula C14H25BN2O3 and a molecular weight of 280.17 g/mol. IUPAC name: 1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: KFQLIKUNPJXHSZ-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O3 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | KFQLIKUNPJXHSZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)(C)COC |
Computed by PubChem (NCBI)