cas: 1354706-66-3 — see every product listed under this CAS number, including other names
1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-3-carboxylic acid, 97% (CAS 1354706-66-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A511041-10g |
| cas | 1354706-66-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 25660.81 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 500mg | 1632.78 Pln | |
| Fluorochem | 1g | 2137.81 Pln | |
| Fluorochem | 2.5g | 3262.41 Pln | |
| Fluorochem | 5g | 4959.73 Pln | |
| Fluorochem | 10g | 8172.14 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2,2-difluoroethyl)-4-iodopyrazole-3-carboxylic acid (CAS 1354706-66-3) is a chemical compound with the molecular formula C6H5F2IN2O2 and a molecular weight of 302.02 g/mol. IUPAC name: 1-(2,2-difluoroethyl)-4-iodopyrazole-3-carboxylic acid. InChIKey: NBDBAHQFYAYJOR-UHFFFAOYSA-N.
| Molecular formula | C6H5F2IN2O2 |
|---|---|
| Molecular weight | 302.02 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)-4-iodopyrazole-3-carboxylic acid |
| InChIKey | NBDBAHQFYAYJOR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)F)C(=O)O)I |
Computed by PubChem (NCBI)